Difference between revisions of "2-AMINOMUCONATE SEMIALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5923 == * common-name: ** 5'-deoxy-5'-fluoroadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))f * inchi-key: ** qp...") |
(Created page with "Category:metabolite == Metabolite 2-AMINOMUCONATE_SEMIALDEHYDE == * common-name: ** (2z,4e)-2-amino-6-oxohexa-2,4-dienoate * smiles: ** c(c=c(c([o-])=o)n)=c[ch]=o * inchi-...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-AMINOMUCONATE_SEMIALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4e)-2-amino-6-oxohexa-2,4-dienoate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c=c(c([o-])=o)n)=c[ch]=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qcgtzpzkjptaep-wftyeqlwsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 140.118 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4e)-2-amino-6-oxohexa-2,4-dienoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qcgtzpzkjptaep-wftyeqlwsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=140.118}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite 2-AMINOMUCONATE_SEMIALDEHYDE
- common-name:
- (2z,4e)-2-amino-6-oxohexa-2,4-dienoate
- smiles:
- c(c=c(c([o-])=o)n)=c[ch]=o
- inchi-key:
- qcgtzpzkjptaep-wftyeqlwsa-m
- molecular-weight:
- 140.118