Difference between revisions of "2-AMINOMUCONATE SEMIALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRAZINOIC-ACID == * common-name: ** pyrazine-2-carboxylate * smiles: ** c1(n=cc=nc=1c([o-])=o) * inchi-key: ** nipzzxufjpqhnh-uhfffaoysa...")
(Created page with "Category:metabolite == Metabolite CPD-11407 == * common-name: ** thyroxine sulfate * smiles: ** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRAZINOIC-ACID ==
+
== Metabolite CPD-11407 ==
 
* common-name:
 
* common-name:
** pyrazine-2-carboxylate
+
** thyroxine sulfate
 
* smiles:
 
* smiles:
** c1(n=cc=nc=1c([o-])=o)
+
** c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
 
* inchi-key:
 
* inchi-key:
** nipzzxufjpqhnh-uhfffaoysa-m
+
** qyxijuzwssqict-lbprgkrzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 123.091
+
** 855.924
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRAZIN-RXN]]
+
* [[RXN-10614]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyrazine-2-carboxylate}}
+
{{#set: common-name=thyroxine sulfate}}
{{#set: inchi-key=inchikey=nipzzxufjpqhnh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=qyxijuzwssqict-lbprgkrzsa-m}}
{{#set: molecular-weight=123.091}}
+
{{#set: molecular-weight=855.924}}

Revision as of 15:31, 5 January 2021

Metabolite CPD-11407

  • common-name:
    • thyroxine sulfate
  • smiles:
    • c2(c(i)=c(oc1(c=c(c(os(=o)(=o)[o-])=c(c=1)i)i))c(=cc=2cc(c(=o)[o-])[n+])i)
  • inchi-key:
    • qyxijuzwssqict-lbprgkrzsa-m
  • molecular-weight:
    • 855.924

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality