Difference between revisions of "2-Acyl-sn-glycerol-3-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...")
(Created page with "Category:metabolite == Metabolite CPD-8990 == * common-name: ** l-methionine-(r)-s-oxide * smiles: ** cs(=o)ccc([n+])c(=o)[o-] * inchi-key: ** qefrnwwlzkmpfj-zxpfjrlxsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-131 ==
+
== Metabolite CPD-8990 ==
 
* common-name:
 
* common-name:
** antheraxanthin
+
** l-methionine-(r)-s-oxide
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
+
** cs(=o)ccc([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ofnsuwbaqrchav-oyquvcaxsa-n
+
** qefrnwwlzkmpfj-zxpfjrlxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 584.881
+
** 165.207
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7979]]
+
* [[1.8.4.14-RXN]]
* [[RXN-7985]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7978]]
 
* [[RXN-7984]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=antheraxanthin}}
+
{{#set: common-name=l-methionine-(r)-s-oxide}}
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
+
{{#set: inchi-key=inchikey=qefrnwwlzkmpfj-zxpfjrlxsa-n}}
{{#set: molecular-weight=584.881}}
+
{{#set: molecular-weight=165.207}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-8990

  • common-name:
    • l-methionine-(r)-s-oxide
  • smiles:
    • cs(=o)ccc([n+])c(=o)[o-]
  • inchi-key:
    • qefrnwwlzkmpfj-zxpfjrlxsa-n
  • molecular-weight:
    • 165.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality