Difference between revisions of "2-Acyl-sn-glycerol-3-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite 2-Acyl-sn-glycerol-3-phosphates == * common-name: ** a 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * [...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-Acyl-sn-glycerol-3-phosphates == |
* common-name: | * common-name: | ||
− | ** 2 | + | ** a 2-acyl-sn-glycerol 3-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13112]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13112]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2 | + | {{#set: common-name=a 2-acyl-sn-glycerol 3-phosphate}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2-Acyl-sn-glycerol-3-phosphates
- common-name:
- a 2-acyl-sn-glycerol 3-phosphate