Difference between revisions of "2-Acyl-sn-glycerol-3-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-131 == * common-name: ** antheraxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc...")
(Created page with "Category:metabolite == Metabolite 2-Acyl-sn-glycerol-3-phosphates == * common-name: ** a 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * [...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD1F-131 ==
+
== Metabolite 2-Acyl-sn-glycerol-3-phosphates ==
 
* common-name:
 
* common-name:
−
** antheraxanthin
+
** a 2-acyl-sn-glycerol 3-phosphate
−
* smiles:
 
−
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc3(c(c)(c)cc(o)cc(c)=3)
 
−
* inchi-key:
 
−
** ofnsuwbaqrchav-oyquvcaxsa-n
 
−
* molecular-weight:
 
−
** 584.881
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-7979]]
+
* [[RXN-13112]]
−
* [[RXN-7985]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-7978]]
+
* [[RXN-13112]]
−
* [[RXN-7984]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=antheraxanthin}}
+
{{#set: common-name=a 2-acyl-sn-glycerol 3-phosphate}}
−
{{#set: inchi-key=inchikey=ofnsuwbaqrchav-oyquvcaxsa-n}}
 
−
{{#set: molecular-weight=584.881}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 2-Acyl-sn-glycerol-3-phosphates

  • common-name:
    • a 2-acyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-Acyl-sn-glycerol-3-phosphates&oldid=138500"