Difference between revisions of "2-Acyl-sn-glycerol-3-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.21.3.1-RXN 1.21.3.1-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.21.3.1-RXN 1.21.3.1-RXN] ==
+
== Metabolite DMPBQ ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 2,3-dimethyl-6-phytyl-1,4-benzoquinol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.21.3.1 ec-1.21.3.1]
+
** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[ISOPENICILLIN-N]][c] '''+''' 2 [[WATER]][c]
+
** sufzkubnovdjrr-wgeodtkdsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ08018]]
+
** 416.686
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-2542]]
−
* [[PWY-5629]], isopenicillin N biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5629 PWY-5629]
+
== Reaction(s) of unknown directionality ==
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
{{#set: common-name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=sufzkubnovdjrr-wgeodtkdsa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=416.686}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22429 22429]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04872 R04872]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.21.3.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:34, 18 December 2020

Metabolite DMPBQ

  • common-name:
    • 2,3-dimethyl-6-phytyl-1,4-benzoquinol
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c
  • inchi-key:
    • sufzkubnovdjrr-wgeodtkdsa-n
  • molecular-weight:
    • 416.686

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-Acyl-sn-glycerol-3-phosphates&oldid=47316"