Difference between revisions of "2-Acyl-sn-glycerol-3-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DMPBQ == * common-name: ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol * smiles: ** cc(cccc(cccc(c)cccc(c)=ccc1(c=c(o)c(c)=c(c)c(o)=1))c)c * in...") |
(Created page with "Category:metabolite == Metabolite LysW-L-ornithine == * common-name: ** a [2-aminoadipate carrier protein]-l-ornithine == Reaction(s) known to consume the compound == * ...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LysW-L-ornithine == |
* common-name: | * common-name: | ||
| − | ** 2 | + | ** a [2-aminoadipate carrier protein]-l-ornithine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-15007]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15007]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2 | + | {{#set: common-name=a [2-aminoadipate carrier protein]-l-ornithine}} |
| − | |||
| − | |||
Revision as of 13:11, 14 January 2021
Contents
Metabolite LysW-L-ornithine
- common-name:
- a [2-aminoadipate carrier protein]-l-ornithine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [2-aminoadipate carrier protein]-l-ornithine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
