Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE == * common-name: ** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite Sphingoid-1-phosphates == * common-name: ** a sphingoid 1-phosphate == Reaction(s) known to consume the compound == == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 1-183-2-183-SN-GLYCEROL-PHOSPHOCHOLINE ==
+
== Metabolite Sphingoid-1-phosphates ==
 
* common-name:
 
* common-name:
−
** 1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine
+
** a sphingoid 1-phosphate
−
* smiles:
 
−
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
−
* inchi-key:
 
−
** xxkfqtjojzelmd-jicbsjgisa-n
 
−
* molecular-weight:
 
−
** 778.06
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-8325]]
+
* [[RXN-11376]]
−
* [[RXN-8331]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=1-α-linolenoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=a sphingoid 1-phosphate}}
−
{{#set: inchi-key=inchikey=xxkfqtjojzelmd-jicbsjgisa-n}}
 
−
{{#set: molecular-weight=778.06}}
 

Revision as of 08:25, 15 March 2021

Metabolite Sphingoid-1-phosphates

  • common-name:
    • a sphingoid 1-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE&oldid=124064"