Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02256 == * transcription-direction: ** negative * right-end-position: ** 10693 * left-end-position: ** 8909 * centisome-position: ** 1.6400476...")
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02256 ==
+
== Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 2-c-methyl-d-erythritol 4-phosphate
−
* right-end-position:
+
* smiles:
−
** 10693
+
** cc(o)(co)c(o)cop([o-])([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 8909
+
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.6400476   
+
** 214.111
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.7.7.60-RXN]]
−
== Reaction(s) associated ==
+
* [[DXPREDISOM-RXN]]
−
* [[3.1.3.16-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[DXPREDISOM-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=214.111}}
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=10693}}
 
−
{{#set: left-end-position=8909}}
 
−
{{#set: centisome-position=1.6400476    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol 4-phosphate
  • smiles:
    • cc(o)(co)c(o)cop([o-])([o-])=o
  • inchi-key:
    • xmwhrvnvkdkbrg-uhnvwzdzsa-l
  • molecular-weight:
    • 214.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE&oldid=137080"