Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...")
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12673 ==
+
== Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE ==
 
* common-name:
 
* common-name:
−
** 5-chloro-5-deoxy-d-ribonate
+
** 2-c-methyl-d-erythritol 4-phosphate
 
* smiles:
 
* smiles:
−
** c(=o)([o-])c(o)c(o)c(o)ccl
+
** cc(o)(co)c(o)cop([o-])([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** ijqsocfskcenow-bxxzvtaosa-m
+
** xmwhrvnvkdkbrg-uhnvwzdzsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 183.568
+
** 214.111
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11717]]
+
* [[2.7.7.60-RXN]]
 +
* [[DXPREDISOM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DXPREDISOM-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
+
{{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}}
−
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
+
{{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}}
−
{{#set: molecular-weight=183.568}}
+
{{#set: molecular-weight=214.111}}

Latest revision as of 11:12, 18 March 2021

Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE

  • common-name:
    • 2-c-methyl-d-erythritol 4-phosphate
  • smiles:
    • cc(o)(co)c(o)cop([o-])([o-])=o
  • inchi-key:
    • xmwhrvnvkdkbrg-uhnvwzdzsa-l
  • molecular-weight:
    • 214.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE&oldid=137080"