Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2184 == * common-name: ** 1-oleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(oc(=o)cc=cccccccc...") |
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-c-methyl-d-erythritol 4-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(co)c(o)cop([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xmwhrvnvkdkbrg-uhnvwzdzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 214.111 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.7.7.60-RXN]] | ||
| + | * [[DXPREDISOM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DXPREDISOM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=214.111}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE
- common-name:
- 2-c-methyl-d-erythritol 4-phosphate
- smiles:
- cc(o)(co)c(o)cop([o-])([o-])=o
- inchi-key:
- xmwhrvnvkdkbrg-uhnvwzdzsa-l
- molecular-weight:
- 214.111
