Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...")
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12673 ==
+
== Metabolite 23-DIPHOSPHOGLYCERATE ==
 
* common-name:
 
* common-name:
−
** 5-chloro-5-deoxy-d-ribonate
+
** 2,3-diphospho-d-glycerate
 
* smiles:
 
* smiles:
−
** c(=o)([o-])c(o)c(o)c(o)ccl
+
** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** ijqsocfskcenow-bxxzvtaosa-m
+
** xohueycvluuejj-uwtatzphsa-i
 
* molecular-weight:
 
* molecular-weight:
−
** 183.568
+
** 260.998
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11717]]
+
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
 +
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 +
* [[RXN-15512]]
 +
* [[RXN-17276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5-chloro-5-deoxy-d-ribonate}}
+
{{#set: common-name=2,3-diphospho-d-glycerate}}
−
{{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}}
+
{{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}}
−
{{#set: molecular-weight=183.568}}
+
{{#set: molecular-weight=260.998}}

Revision as of 14:54, 5 January 2021

Metabolite 23-DIPHOSPHOGLYCERATE

  • common-name:
    • 2,3-diphospho-d-glycerate
  • smiles:
    • c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
  • inchi-key:
    • xohueycvluuejj-uwtatzphsa-i
  • molecular-weight:
    • 260.998

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE&oldid=58922"