Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...") |
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23-DIPHOSPHOGLYCERATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2,3-diphospho-d-glycerate |
* smiles: | * smiles: | ||
− | ** c(=o)([o-])c(o) | + | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xohueycvluuejj-uwtatzphsa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 260.998 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-15509]] |
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15512]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] | ||
+ | * [[RXN-15509]] | ||
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15512]] | ||
+ | * [[RXN-17276]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2,3-diphospho-d-glycerate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=260.998}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- molecular-weight:
- 260.998