Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21400 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol 4-phosphate * smiles: ** cc(o)(co)c(o)cop([o-])([o-])=o...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE == |
| − | + | * common-name: | |
| − | * | + | ** 2-c-methyl-d-erythritol 4-phosphate |
| − | + | * smiles: | |
| − | * | + | ** cc(o)(co)c(o)cop([o-])([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** xmwhrvnvkdkbrg-uhnvwzdzsa-l |
| − | * | + | * molecular-weight: |
| − | * | + | ** 214.111 |
| − | *** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[2.7.7.60-RXN]] |
| − | * [[ | + | * [[DXPREDISOM-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[DXPREDISOM-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=2-c-methyl-d-erythritol 4-phosphate}} |
| + | {{#set: inchi-key=inchikey=xmwhrvnvkdkbrg-uhnvwzdzsa-l}} | ||
| + | {{#set: molecular-weight=214.111}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE
- common-name:
- 2-c-methyl-d-erythritol 4-phosphate
- smiles:
- cc(o)(co)c(o)cop([o-])([o-])=o
- inchi-key:
- xmwhrvnvkdkbrg-uhnvwzdzsa-l
- molecular-weight:
- 214.111
