Difference between revisions of "2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21400 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-12673 == * common-name: ** 5-chloro-5-deoxy-d-ribonate * smiles: ** c(=o)([o-])c(o)c(o)c(o)ccl * inchi-key: ** ijqsocfskcenow-bxxzvta...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12673 == |
| − | + | * common-name: | |
| − | * | + | ** 5-chloro-5-deoxy-d-ribonate |
| − | + | * smiles: | |
| − | * | + | ** c(=o)([o-])c(o)c(o)c(o)ccl |
| − | * | + | * inchi-key: |
| − | ** | + | ** ijqsocfskcenow-bxxzvtaosa-m |
| − | * | + | * molecular-weight: |
| − | * | + | ** 183.568 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN-11717]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=5-chloro-5-deoxy-d-ribonate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=ijqsocfskcenow-bxxzvtaosa-m}} |
| − | {{#set: | + | {{#set: molecular-weight=183.568}} |
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-12673
- common-name:
- 5-chloro-5-deoxy-d-ribonate
- smiles:
- c(=o)([o-])c(o)c(o)c(o)ccl
- inchi-key:
- ijqsocfskcenow-bxxzvtaosa-m
- molecular-weight:
- 183.568
