Difference between revisions of "2-CARBOXY-D-ARABINITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL == * common-name: ** 2-carboxy-d-arabinitol * smiles: ** c(c(c(c(c([o-])=o)(co)o)o)o)o * inchi-key: ** xondrgralzt...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-CARBOXY-D-ARABINITOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-carboxy-d-arabinitol |
| + | * smiles: | ||
| + | ** c(c(c(c(c([o-])=o)(co)o)o)o)o | ||
| + | * inchi-key: | ||
| + | ** xondrgralztvkd-zmizwqjlsa-m | ||
| + | * molecular-weight: | ||
| + | ** 195.149 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-carboxy-d-arabinitol}} |
| + | {{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}} | ||
| + | {{#set: molecular-weight=195.149}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 2-CARBOXY-D-ARABINITOL
- common-name:
- 2-carboxy-d-arabinitol
- smiles:
- c(c(c(c(c([o-])=o)(co)o)o)o)o
- inchi-key:
- xondrgralztvkd-zmizwqjlsa-m
- molecular-weight:
- 195.149
