Difference between revisions of "2-DEHYDROPANTOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C5 == * common-name: ** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine *...")
(Created page with "Category:metabolite == Metabolite Holo-EntF == * common-name: ** a holo-[entf peptidyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C5 ==
+
== Metabolite Holo-EntF ==
 
* common-name:
 
* common-name:
** undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** a holo-[entf peptidyl-carrier protein]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc([n+])c(=o)[o-])c(nc(c)c(=o)nc(c)c([o-])=o)=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
 
* inchi-key:
 
** pnwzqtonlrrpst-kldrqjoasa-j
 
* molecular-weight:
 
** 1713.036
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[RXN-15889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=undecaprenyldiphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=a holo-[entf peptidyl-carrier protein]}}
{{#set: inchi-key=inchikey=pnwzqtonlrrpst-kldrqjoasa-j}}
 
{{#set: molecular-weight=1713.036}}
 

Revision as of 11:16, 15 January 2021

Metabolite Holo-EntF

  • common-name:
    • a holo-[entf peptidyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a holo-[entf peptidyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.