Difference between revisions of "2-DEOXY-D-GLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RNA-Holder == * common-name: ** a ribonucleic acid == Reaction(s) known to consume the compound == * 3.1.27.1-RXN * 3.1.27.5-RXN...")
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RNA-Holder ==
+
== Metabolite OXALACETIC_ACID ==
 
* common-name:
 
* common-name:
** a ribonucleic acid
+
** oxaloacetate
 +
* smiles:
 +
** c(c([o-])=o)c(=o)c([o-])=o
 +
* inchi-key:
 +
** khpxuqmniqbqev-uhfffaoysa-l
 +
* molecular-weight:
 +
** 130.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.27.1-RXN]]
+
* [[ASPAMINOTRANS-RXN]]
* [[3.1.27.5-RXN]]
+
* [[CITSYN-RXN]]
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[CSm]]
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[MALATE-DEH-RXN]]
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
+
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALODECARB-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[ASPAMINOTRANS-RXN]]
* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
* [[RNA-LIGASE-ATP-RXN]]
+
* [[ATPCL]]
* [[RNA-URIDYLYLTRANSFERASE-RXN]]
+
* [[MALATE-DEH-RXN]]
* [[RXN-17927]]
+
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PPC]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ribonucleic acid}}
+
{{#set: common-name=oxaloacetate}}
 +
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
 +
{{#set: molecular-weight=130.057}}

Revision as of 08:24, 15 March 2021