Difference between revisions of "2-DEOXY-D-GLUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...") |
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE == * common-name: ** 2-deoxy-d-glucose == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-DEOXY-D-GLUCOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-deoxy-d-glucose |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.3.68-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-deoxy-d-glucose}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 2-DEOXY-D-GLUCOSE
- common-name:
- 2-deoxy-d-glucose
