Difference between revisions of "2-DEOXY-D-GLUCOSE-6-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09958 == * transcription-direction: ** positive * right-end-position: ** 110516 * left-end-position: ** 107147 * centisome-position: ** 26.660845...")
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == * common-name: ** 2-deoxy-d-glucose 6-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) * in...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09958 ==
+
== Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE ==
* transcription-direction:
+
* common-name:
** positive
+
** 2-deoxy-d-glucose 6-phosphate
* right-end-position:
+
* smiles:
** 110516
+
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 107147
+
** uqjfzaagzayvkz-cermhhmhsa-l
* centisome-position:
+
* molecular-weight:
** 26.660845   
+
** 242.122
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[3.1.3.68-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
* [[ATP-PYROPHOSPHATASE-RXN]]
+
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=242.122}}
* [[ATPASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-11396]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12195]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-12196]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-5462]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN0-6957]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
</div>
 
== Pathway(s) associated ==
 
* [[PWY-6502]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-7210]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=110516}}
 
{{#set: left-end-position=107147}}
 
{{#set: centisome-position=26.660845    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=8}}
 
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE

  • common-name:
    • 2-deoxy-d-glucose 6-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
  • inchi-key:
    • uqjfzaagzayvkz-cermhhmhsa-l
  • molecular-weight:
    • 242.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality