Difference between revisions of "2-DEOXY-D-GLUCOSE-6-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NN-dimethyl-terminal-PPK == * common-name: ** an n terminal n,n-dimethyl-ppk-[protein] == Reaction(s) known to consume the compound == ==...")
(Created page with "Category:metabolite == Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE == * common-name: ** 2-deoxy-d-glucose 6-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1) * in...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NN-dimethyl-terminal-PPK ==
+
== Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE ==
 
* common-name:
 
* common-name:
** an n terminal n,n-dimethyl-ppk-[protein]
+
** 2-deoxy-d-glucose 6-phosphate
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
 +
* inchi-key:
 +
** uqjfzaagzayvkz-cermhhmhsa-l
 +
* molecular-weight:
 +
** 242.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.1.3.68-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13226]]
 
* [[RXN-13228]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n terminal n,n-dimethyl-ppk-[protein]}}
+
{{#set: common-name=2-deoxy-d-glucose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=uqjfzaagzayvkz-cermhhmhsa-l}}
 +
{{#set: molecular-weight=242.122}}

Latest revision as of 11:13, 18 March 2021

Metabolite 2-DEOXY-D-GLUCOSE-6-PHOSPHATE

  • common-name:
    • 2-deoxy-d-glucose 6-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c1(oc(o)cc(o)c(o)1)
  • inchi-key:
    • uqjfzaagzayvkz-cermhhmhsa-l
  • molecular-weight:
    • 242.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality