Difference between revisions of "2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...") |
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == * common-name: ** 3-demethylubiquinol-6 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-demethylubiquinol-6 |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zqxnznkhqxlvcv-hgjbzhbgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 578.874 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-102]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-demethylubiquinol-6}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zqxnznkhqxlvcv-hgjbzhbgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=578.874}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX
- common-name:
- 3-demethylubiquinol-6
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- zqxnznkhqxlvcv-hgjbzhbgsa-n
- molecular-weight:
- 578.874
