Difference between revisions of "2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16426 RXN-16426] == * direction: ** left-to-right == Reaction formula == * 1 N-ACETYL-D-GLUCO...") |
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11690 == |
− | * | + | * common-name: |
− | ** | + | ** 1-oleoyl-sn-glycerol |
− | + | * smiles: | |
− | * | + | ** ccccccccc=ccccccccc(=o)occ(co)o |
− | = | + | * inchi-key: |
− | * | + | ** rzrnayuhwvfmip-qjrazlaksa-n |
− | ** | + | * molecular-weight: |
− | + | ** 356.545 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-15089]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=1-oleoyl-sn-glycerol}} |
− | + | {{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}} | |
− | == | + | {{#set: molecular-weight=356.545}} |
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-11690
- common-name:
- 1-oleoyl-sn-glycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(co)o
- inchi-key:
- rzrnayuhwvfmip-qjrazlaksa-n
- molecular-weight:
- 356.545