Difference between revisions of "2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * smiles: ** c(#n)[s-] * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * molecular-weight: ** 58.078 ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HSCN == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiocyanate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(#n)[s-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zmzdmbwjuhkjps-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 58.078 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[RXN0-6359]] |
| + | * [[THIOSULFATE-SULFURTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiocyanate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zmzdmbwjuhkjps-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=58.078}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite HSCN
- common-name:
- thiocyanate
- smiles:
- c(#n)[s-]
- inchi-key:
- zmzdmbwjuhkjps-uhfffaoysa-m
- molecular-weight:
- 58.078
