Difference between revisions of "2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...")
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite O-SINAPOYLCHOLINE ==
+
== Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ ==
 
* common-name:
 
* common-name:
−
** o-sinapoylcholine
+
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
−
** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
−
** hujxhfrxwwgyqh-uhfffaoysa-o
+
** atqqulxelmejix-nsuijkaqsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 310.369
+
** 562.874
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.3.1.91-RXN]]
+
* [[RXN3O-54]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=o-sinapoylcholine}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
−
{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
−
{{#set: molecular-weight=310.369}}
+
{{#set: molecular-weight=562.874}}

Latest revision as of 11:13, 18 March 2021

Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
  • inchi-key:
    • atqqulxelmejix-nsuijkaqsa-n
  • molecular-weight:
    • 562.874

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ&oldid=137779"