Difference between revisions of "2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-323 == * common-name: ** cholest-4-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inchi...")
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol * smiles: ** cc(c)...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-323 ==
+
== Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ ==
 
* common-name:
 
* common-name:
** cholest-4-en-3-one
+
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** nyoxryyxrwjdkp-gykmgiidsa-n
+
** atqqulxelmejix-nsuijkaqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 562.874
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 
* [[RXN-12848]]
 
* [[RXN-17644]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN3O-54]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholest-4-en-3-one}}
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=nyoxryyxrwjdkp-gykmgiidsa-n}}
+
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=562.874}}

Latest revision as of 11:13, 18 March 2021

Metabolite 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
  • inchi-key:
    • atqqulxelmejix-nsuijkaqsa-n
  • molecular-weight:
    • 562.874

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality