Difference between revisions of "2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-SINAPOYLCHOLINE == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c * inchi-key: ** hu...")
(Created page with "Category:metabolite == Metabolite CPD-323 == * common-name: ** cholest-4-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-SINAPOYLCHOLINE ==
+
== Metabolite CPD-323 ==
 
* common-name:
 
* common-name:
** o-sinapoylcholine
+
** cholest-4-en-3-one
 
* smiles:
 
* smiles:
** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
+
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** hujxhfrxwwgyqh-uhfffaoysa-o
+
** nyoxryyxrwjdkp-gykmgiidsa-n
 
* molecular-weight:
 
* molecular-weight:
** 310.369
+
** 384.644
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 +
* [[RXN-12848]]
 +
* [[RXN-17644]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.3.1.91-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-sinapoylcholine}}
+
{{#set: common-name=cholest-4-en-3-one}}
{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=nyoxryyxrwjdkp-gykmgiidsa-n}}
{{#set: molecular-weight=310.369}}
+
{{#set: molecular-weight=384.644}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-323

  • common-name:
    • cholest-4-en-3-one
  • smiles:
    • cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • nyoxryyxrwjdkp-gykmgiidsa-n
  • molecular-weight:
    • 384.644

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality