Difference between revisions of "2-Hexadecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...") |
(Created page with "Category:metabolite == Metabolite 2-Hexadecenoyl-ACPs == * common-name: ** a trans hexadecenoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9542 * RX...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-Hexadecenoyl-ACPs == |
* common-name: | * common-name: | ||
− | ** | + | ** a trans hexadecenoyl-[acp] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9542]] |
− | * [[ | + | * [[RXN-9663]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4.2.1.61-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trans hexadecenoyl-[acp]}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 2-Hexadecenoyl-ACPs
- common-name:
- a trans hexadecenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a trans hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.