Difference between revisions of "2-Hexadecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01956 == * transcription-direction: ** positive * right-end-position: ** 20368 * left-end-position: ** 14814 * centisome-position: ** 10.326728...") |
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL == * common-name: ** 2-carboxy-d-arabinitol * smiles: ** c(c(c(c(c([o-])=o)(co)o)o)o)o * inchi-key: ** xondrgralzt...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-CARBOXY-D-ARABINITOL == |
− | * | + | * common-name: |
− | ** | + | ** 2-carboxy-d-arabinitol |
− | * | + | * smiles: |
− | ** | + | ** c(c(c(c(c([o-])=o)(co)o)o)o)o |
− | * | + | * inchi-key: |
− | ** | + | ** xondrgralztvkd-zmizwqjlsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 195.149 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=2-carboxy-d-arabinitol}} | |
− | + | {{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}} | |
− | + | {{#set: molecular-weight=195.149}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite 2-CARBOXY-D-ARABINITOL
- common-name:
- 2-carboxy-d-arabinitol
- smiles:
- c(c(c(c(c([o-])=o)(co)o)o)o)o
- inchi-key:
- xondrgralztvkd-zmizwqjlsa-m
- molecular-weight:
- 195.149