Difference between revisions of "2-Hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...")
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ALPHA-ACETYLORNITHINE ==
+
== Metabolite CPD-12016 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-ornithine
+
** n-acetyl-serotonin glucuronide
 
* smiles:
 
* smiles:
** cc(=o)nc(ccc[n+])c(=o)[o-]
+
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
 
* inchi-key:
 
* inchi-key:
** jrlgpaxaghmnol-lurjtmiesa-n
+
** drkqfnyksnwotc-rngzqalnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 174.199
+
** 393.372
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLORNDEACET-RXN]]
 
* [[ACETYLORNTRANSAM-RXN]]
 
* [[AODAA]]
 
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLORNDEACET-RXN]]
+
* [[RXN-11060]]
* [[ACETYLORNTRANSAM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-ornithine}}
+
{{#set: common-name=n-acetyl-serotonin glucuronide}}
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
{{#set: molecular-weight=174.199}}
+
{{#set: molecular-weight=393.372}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-12016

  • common-name:
    • n-acetyl-serotonin glucuronide
  • smiles:
    • cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
  • inchi-key:
    • drkqfnyksnwotc-rngzqalnsa-m
  • molecular-weight:
    • 393.372

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality