Difference between revisions of "2-KETO-3-METHYL-VALERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...") |
(Created page with "Category:metabolite == Metabolite Ribonucleoside-Diphosphates == * common-name: ** a ribonucleoside diphosphate == Reaction(s) known to consume the compound == * RIBONUC...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ribonucleoside-Diphosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a ribonucleoside diphosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a ribonucleoside diphosphate}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite Ribonucleoside-Diphosphates
- common-name:
- a ribonucleoside diphosphate
