Difference between revisions of "2-KETO-GLUTARAMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-HEXOSE-6-PHOSPHATE == * common-name: ** d-hexose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** nbs...")
(Created page with "Category:metabolite == Metabolite PROT-CYS == * common-name: ** a [protein]-l-cysteine == Reaction(s) known to consume the compound == * 1.11.1.15-RXN * 2.1.1.63-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-HEXOSE-6-PHOSPHATE ==
+
== Metabolite PROT-CYS ==
 
* common-name:
 
* common-name:
** d-hexose 6-phosphate
+
** a [protein]-l-cysteine
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
** nbschqhzlsjfnq-uhfffaoysa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.11.1.15-RXN]]
 +
* [[2.1.1.63-RXN]]
 +
* [[2.5.1.58-RXN]]
 +
* [[RXN-14554]]
 +
* [[RXN-3701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEXOKINASE-RXN]]
+
* [[2.5.1.58-RXN]]
 +
* [[RXN-16820]]
 +
* [[RXN-3701]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-hexose 6-phosphate}}
+
{{#set: common-name=a [protein]-l-cysteine}}
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-uhfffaoysa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 13:09, 14 January 2021

Metabolite PROT-CYS

  • common-name:
    • a [protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.