Difference between revisions of "2-KETO-GLUTARAMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-HEXOSE-6-PHOSPHATE == * common-name: ** d-hexose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** nbs...") |
(Created page with "Category:metabolite == Metabolite PROT-CYS == * common-name: ** a [protein]-l-cysteine == Reaction(s) known to consume the compound == * 1.11.1.15-RXN * 2.1.1.63-RXN...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROT-CYS == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-cysteine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.11.1.15-RXN]] | ||
+ | * [[2.1.1.63-RXN]] | ||
+ | * [[2.5.1.58-RXN]] | ||
+ | * [[RXN-14554]] | ||
+ | * [[RXN-3701]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.5.1.58-RXN]] |
+ | * [[RXN-16820]] | ||
+ | * [[RXN-3701]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-cysteine}} |
− | |||
− |
Revision as of 13:09, 14 January 2021
Contents
Metabolite PROT-CYS
- common-name:
- a [protein]-l-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.