Difference between revisions of "2-KETO-ISOVALERATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...")
(Created page with "Category:metabolite == Metabolite Phosphoacetylglucosamine-Mutase == * common-name: ** a phosphoacetylglucosamine mutase == Reaction(s) known to consume the compound == *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-P-SERINE ==
+
== Metabolite Phosphoacetylglucosamine-Mutase ==
 
* common-name:
 
* common-name:
** 3-phospho-l-serine
+
** a phosphoacetylglucosamine mutase
* smiles:
 
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
 
* inchi-key:
 
** bzqfbwgglxlepq-reohclbhsa-l
 
* molecular-weight:
 
** 183.057
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-16426]]
* [[RXN0-5114]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-16425]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-l-serine}}
+
{{#set: common-name=a phosphoacetylglucosamine mutase}}
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
 
{{#set: molecular-weight=183.057}}
 

Revision as of 18:58, 14 January 2021

Metabolite Phosphoacetylglucosamine-Mutase

  • common-name:
    • a phosphoacetylglucosamine mutase

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality