Difference between revisions of "2-KETO-ISOVALERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-RADYL-2-ACETYL-SN-GLYCERO-3-PHOSPHOLIP == * smiles: ** cc(=o)oc(co[r1])cop(=o)([o-])o[r2] * common-name: ** 1-organyl-2-acetyl-sn-glyce...") |
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11408 == |
| + | * common-name: | ||
| + | ** triiodothyronine sulfate | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i) |
| − | * | + | * inchi-key: |
| − | ** | + | ** xbqyqxvjbndcgy-lbprgkrzsa-m |
| + | * molecular-weight: | ||
| + | ** 730.028 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10615]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyronine sulfate}} |
| + | {{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}} | ||
| + | {{#set: molecular-weight=730.028}} | ||
Revision as of 15:30, 5 January 2021
Contents
Metabolite CPD-11408
- common-name:
- triiodothyronine sulfate
- smiles:
- c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
- inchi-key:
- xbqyqxvjbndcgy-lbprgkrzsa-m
- molecular-weight:
- 730.028
