Difference between revisions of "2-Lysophosphatidylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17272 == * common-name: ** 1-oleoyl-2-palmitoyl-glycerol * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-key...")
(Created page with "Category:metabolite == Metabolite ISOBUTYRYL-COA == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17272 ==
+
== Metabolite ISOBUTYRYL-COA ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-palmitoyl-glycerol
+
** isobutanoyl-coa
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** dozkmfvmcatmeh-ozktzcccsa-n
+
** aewhywspvrzhct-ndzskpawsa-j
 
* molecular-weight:
 
* molecular-weight:
** 594.957
+
** 833.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16027]]
+
* [[2.3.1.168-RXN]]
 +
* [[MCDH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16027]]
+
* [[1.2.1.25-RXN]]
 +
* [[2.3.1.168-RXN]]
 +
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-palmitoyl-glycerol}}
+
{{#set: common-name=isobutanoyl-coa}}
{{#set: inchi-key=inchikey=dozkmfvmcatmeh-ozktzcccsa-n}}
+
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
{{#set: molecular-weight=594.957}}
+
{{#set: molecular-weight=833.593}}

Revision as of 08:31, 15 March 2021

Metabolite ISOBUTYRYL-COA

  • common-name:
    • isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • aewhywspvrzhct-ndzskpawsa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality