|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSTEINASE-RXN ADENOSYLHOMOCYSTEINASE-RXN] == | + | == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** s-adenosylhomocysteine hydrolase | + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.3.1.1 ec-3.3.1.1] | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[ADENOSINE]][c] '''+''' 1 [[HOMO-CYS]][c]
| + | ** qkmbynrmprkvto-mnovxskesa-k |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ07466]]
| + | ** 346.21 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[IGPSYN-RXN]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[PRAISOM-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}} |
| − | * [[METHIONINE-DEG1-PWY]], L-methionine degradation I (to L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-DEG1-PWY METHIONINE-DEG1-PWY] | + | {{#set: molecular-weight=346.21}} |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5041]], S-adenosyl-L-methionine cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21711 21711]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00192 R00192]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P10760 P10760]
| |
| − | ** [http://www.uniprot.org/uniprot/P10819 P10819]
| |
| − | ** [http://www.uniprot.org/uniprot/P23526 P23526]
| |
| − | ** [http://www.uniprot.org/uniprot/P28183 P28183]
| |
| − | ** [http://www.uniprot.org/uniprot/P50250 P50250]
| |
| − | ** [http://www.uniprot.org/uniprot/P60176 P60176]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58783 Q58783]
| |
| − | ** [http://www.uniprot.org/uniprot/O23255 O23255]
| |
| − | ** [http://www.uniprot.org/uniprot/O27673 O27673]
| |
| − | ** [http://www.uniprot.org/uniprot/O29376 O29376]
| |
| − | ** [http://www.uniprot.org/uniprot/O28279 O28279]
| |
| − | ** [http://www.uniprot.org/uniprot/P51893 P51893]
| |
| − | ** [http://www.uniprot.org/uniprot/P50245 P50245]
| |
| − | ** [http://www.uniprot.org/uniprot/P26799 P26799]
| |
| − | ** [http://www.uniprot.org/uniprot/P35007 P35007]
| |
| − | ** [http://www.uniprot.org/uniprot/P39954 P39954]
| |
| − | ** [http://www.uniprot.org/uniprot/P50252 P50252]
| |
| − | ** [http://www.uniprot.org/uniprot/P50249 P50249]
| |
| − | ** [http://www.uniprot.org/uniprot/P74008 P74008]
| |
| − | ** [http://www.uniprot.org/uniprot/P32112 P32112]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9UG84 Q9UG84]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01781 Q01781]
| |
| − | ** [http://www.uniprot.org/uniprot/P27604 P27604]
| |
| − | </div>
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=s-adenosylhomocysteine hydrolase}} | |
| − | {{#set: ec-number=ec-3.3.1.1}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_nannochloropsis_salina}}
| |
