Difference between revisions of "2-METHYL-3-HYDROXY-BUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] == * direction: ** left-to-right * common-name: ** fatty acid synthase * ec-numb...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9535 RXN-9535] ==
+
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** fatty acid synthase
+
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179]
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41]
+
* inchi-key:
** [http://enzyme.expasy.org/EC/2.3.1.85 ec-2.3.1.85]
+
** pekyntfsobaabv-lqudnsjzsa-j
** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
+
* molecular-weight:
* synonymous:
+
** 863.619
** acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] c-acyltransferase (decarboxylating)
+
== Reaction(s) known to consume the compound ==
** β-ketoacyl acyl carrier protein synthase
+
* [[1.1.1.178-RXN]]
** β-ketoacyl-acp synthase i
+
* [[HMNOS]]
** condensing enzyme
+
* [[TIGLYLCOA-HYDROXY-RXN]]
** β-ketoacyl-[acyl carrier protein] synthase
+
== Reaction(s) known to produce the compound ==
** β-ketoacyl-acyl carrier protein synthetase
+
* [[1.1.1.178-RXN]]
** 3-oxoacyl-[acyl-carrier-protein] synthase
+
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
== Reaction formula ==
+
* [[HMNOS]]
* 1 [[Dodecanoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-oxo-myristoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[TIGLYLCOA-HYDROXY-RXN]]
== Gene(s) associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
* Gene: [[SJ15984]]
+
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=863.619}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ17743]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ06616]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ03883]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ00005]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ06617]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ00613]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ18059]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ13014]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ04769]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ10624]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ00320]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ15983]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ06944]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11672]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ19629]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ04443]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 
** '''31''' reactions found over '''31''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=fatty acid synthase}}
 
{{#set: ec-number=ec-2.3.1.41|ec-2.3.1.86|ec-2.3.1.85|ec-2.3.1.179}}
 
{{#set: synonymous=&beta;-ketoacyl-acp synthase i|&beta;-ketoacyl acyl carrier protein synthase|condensing enzyme|&beta;-ketoacyl-[acyl carrier protein] synthase|acyl-[acyl-carrier-protein]:malonyl-[acyl-carrier-protein] c-acyltransferase (decarboxylating)|&beta;-ketoacyl-acyl carrier protein synthetase|3-oxoacyl-[acyl-carrier-protein] synthase}}
 
{{#set: nb gene associated=17}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA

  • common-name:
    • (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
  • inchi-key:
    • pekyntfsobaabv-lqudnsjzsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality