Difference between revisions of "2-METHYL-3-HYDROXY-BUTYRYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7421 RXN-7421] == * direction: ** left-to-right * common-name: ** cyclopropane synthase * ec-nu...")
 
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7421 RXN-7421] ==
+
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** cyclopropane synthase
+
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.79 ec-2.1.1.79]
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
== Reaction formula ==
+
* inchi-key:
* 1 [[Oleoyl-lipid]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[Lipid-dihydrosterculate]][c] '''+''' 1 [[PROTON]][c]
+
** pekyntfsobaabv-lqudnsjzsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ13641]]
+
** 863.619
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.1.1.178-RXN]]
** Category: [[orthology]]
+
* [[HMNOS]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[TIGLYLCOA-HYDROXY-RXN]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-4942]], sterculate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4942 PWY-4942]
+
* [[1.1.1.178-RXN]]
** '''1''' reactions found over '''2''' reactions in the full pathway
+
* [[ECH_LPAREN_3hmbcoa_RPAREN_]]
== Reconstruction information  ==
+
* [[HMNOS]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[TIGLYLCOA-HYDROXY-RXN]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}
{{#set: common-name=cyclopropane synthase}}
+
{{#set: molecular-weight=863.619}}
{{#set: ec-number=ec-2.1.1.79}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA

  • common-name:
    • (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
  • inchi-key:
    • pekyntfsobaabv-lqudnsjzsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality