Difference between revisions of "2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Digalactosylceramides == * common-name: ** a digalactosylceramide == Reaction(s) known to consume the compound == * RXN-18303 == Reac...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE == * common-name: ** phylloquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phylloquinone |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c) | ||
| + | * inchi-key: | ||
| + | ** mbwxntaxlnyfjb-lkudqcmesa-n | ||
| + | * molecular-weight: | ||
| + | ** 450.703 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[1.1.4.1-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[1.1.4.1-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phylloquinone}} |
| + | {{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}} | ||
| + | {{#set: molecular-weight=450.703}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE
- common-name:
- phylloquinone
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
- inchi-key:
- mbwxntaxlnyfjb-lkudqcmesa-n
- molecular-weight:
- 450.703
