Difference between revisions of "2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19850 == * transcription-direction: ** positive * right-end-position: ** 106576 * left-end-position: ** 93360 * centisome-position: ** 42.640846...")
 
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE == * common-name: ** phylloquinone * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19850 ==
+
== Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** phylloquinone
−
* right-end-position:
+
* smiles:
−
** 106576
+
** cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
−
* left-end-position:
+
* inchi-key:
−
** 93360
+
** mbwxntaxlnyfjb-lkudqcmesa-n
−
* centisome-position:
+
* molecular-weight:
−
** 42.640846   
+
** 450.703
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[1.1.4.1-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PEROXID-RXN]]
+
* [[1.1.4.1-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=phylloquinone}}
−
* [[RXN-14240]]
+
{{#set: inchi-key=inchikey=mbwxntaxlnyfjb-lkudqcmesa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=450.703}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=106576}}
 
−
{{#set: left-end-position=93360}}
 
−
{{#set: centisome-position=42.640846    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite 2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE

  • common-name:
    • phylloquinone
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)=ccc2(=c(c(=o)c1(c=cc=cc=1c2=o))c)
  • inchi-key:
    • mbwxntaxlnyfjb-lkudqcmesa-n
  • molecular-weight:
    • 450.703

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE&oldid=136701"