Difference between revisions of "2-METHYL-3-PHYTYL-14-NAPHTHOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-786 == * common-name: ** (4z)-2-oxohept-4-enedioate * smiles: ** c(ccc=cc(c([o-])=o)=o)([o-])=o * inchi-key: ** hyvszvzmtyihkf-iwqzzh...") |
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == * common-name: ** an l-1-phosphatidylethanolamine == Reaction(s) known to consume the compound == * 2....") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** an l-1-phosphatidylethanolamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.1.1.17-RXN]] | ||
| + | * [[RXN-1382]] | ||
| + | * [[RXN0-6725]] | ||
| + | * [[RXN0-6952]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
| + | * [[RXN-1382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an l-1-phosphatidylethanolamine}} |
| − | |||
| − | |||
Revision as of 15:24, 5 January 2021
Contents
Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE
- common-name:
- an l-1-phosphatidylethanolamine
