Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MI-HEXAKISPHOSPHATE == * common-name: ** phytate * smiles: ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite MI-HEXAKISPHOSPHATE ==
+
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
 
* common-name:
 
* common-name:
−
** phytate
+
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
−
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
+
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
 
* inchi-key:
 
* inchi-key:
−
** imqlkjbteoyosi-gpivlxjgsa-b
+
** swkaczqjgxabcn-jsgwljpksa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 647.942
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.152-RXN]]
+
* [[RXN-2762]]
−
* [[RXN-10971]]
 
−
* [[RXN-10972]]
 
−
* [[RXN-10977]]
 
−
* [[RXN-10978]]
 
−
* [[RXN-7186]]
 
−
* [[RXN-7241]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10964]]
+
* [[RXN-2761]]
−
* [[RXN-10977]]
 
−
* [[RXN-10978]]
 
−
* [[RXN-7163]]
 
−
* [[RXN-7186]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=phytate}}
+
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
−
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
+
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
−
{{#set: molecular-weight=647.942}}
+
{{#set: molecular-weight=737.203}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE

  • common-name:
    • 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
  • inchi-key:
    • swkaczqjgxabcn-jsgwljpksa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-METHYL-6-SOLANYL-14-BENZOQUINONE&oldid=138722"