Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-320 == * common-name: ** ethylnitronate * smiles: ** cc=n(=o)[o-] * inchi-key: ** yerbbvnyiklxdm-uhfffaoysa-n * molecular-weight: **...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-320 ==
+
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
 
* common-name:
 
* common-name:
** ethylnitronate
+
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** cc=n(=o)[o-]
+
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
 
* inchi-key:
 
* inchi-key:
** yerbbvnyiklxdm-uhfffaoysa-n
+
** swkaczqjgxabcn-jsgwljpksa-n
 
* molecular-weight:
 
* molecular-weight:
** 74.059
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
+
* [[RXN-2762]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-2761]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ethylnitronate}}
+
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=yerbbvnyiklxdm-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
{{#set: molecular-weight=74.059}}
+
{{#set: molecular-weight=737.203}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE

  • common-name:
    • 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
  • inchi-key:
    • swkaczqjgxabcn-jsgwljpksa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality