Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-2-me-oxy-2-oxo-et-ur-34-tRNA == * common-name: ** a 5-(2-methoxy-2-oxoethyl)uridine34 in trna == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...") |
||
(4 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol |
+ | * smiles: | ||
+ | ** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** swkaczqjgxabcn-jsgwljpksa-n | ||
+ | * molecular-weight: | ||
+ | ** 737.203 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2762]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-2761]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}} |
+ | {{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}} | ||
+ | {{#set: molecular-weight=737.203}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE
- common-name:
- 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
- inchi-key:
- swkaczqjgxabcn-jsgwljpksa-n
- molecular-weight:
- 737.203