Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CU+ == * common-name: ** cu+ * smiles: ** [cu+] * inchi-key: ** vmqmzmrvkuzkql-uhfffaoysa-n * molecular-weight: ** 64.554 == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CU+ ==
+
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
 
* common-name:
 
* common-name:
−
** cu+
+
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
−
** [cu+]
+
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
 
* inchi-key:
 
* inchi-key:
−
** vmqmzmrvkuzkql-uhfffaoysa-n
+
** swkaczqjgxabcn-jsgwljpksa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 64.554
+
** 737.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ExchangeSeed-CU+]]
+
* [[RXN-2762]]
−
* [[RXN-14455]]
 
−
* [[TransportSeed-CU+]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[ExchangeSeed-CU+]]
+
* [[RXN-2761]]
−
* [[RXN-14455]]
 
−
* [[TransportSeed-CU+]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=cu+}}
+
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
−
{{#set: inchi-key=inchikey=vmqmzmrvkuzkql-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
−
{{#set: molecular-weight=64.554}}
+
{{#set: molecular-weight=737.203}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE

  • common-name:
    • 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
  • inchi-key:
    • swkaczqjgxabcn-jsgwljpksa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-METHYL-6-SOLANYL-14-BENZOQUINONE&oldid=138722"