Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=XPPRT XPPRT] == * direction: ** reversible * common-name: ** xmp:pyrophosphate phosphoribosyltransf...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol |
− | == | + | * smiles: |
− | + | ** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c | |
− | == | + | * inchi-key: |
− | * | + | ** swkaczqjgxabcn-jsgwljpksa-n |
− | ** | + | * molecular-weight: |
− | ** | + | ** 737.203 |
− | == | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[RXN-2762]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-2761]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: common-name= | + | {{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}} |
− | + | {{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=737.203}} |
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE
- common-name:
- 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
- inchi-key:
- swkaczqjgxabcn-jsgwljpksa-n
- molecular-weight:
- 737.203