Difference between revisions of "2-METHYL-6-SOLANYL-14-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=XPPRT XPPRT] == * direction: ** reversible * common-name: ** xmp:pyrophosphate phosphoribosyltransf...")
(Created page with "Category:metabolite == Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE == * common-name: ** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cc...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=XPPRT XPPRT] ==
+
== Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** xmp:pyrophosphate phosphoribosyltransferase
+
** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
== Reaction formula ==
+
* smiles:
* 1.0 [[PRPP]][c] '''+''' 1.0 [[XANTHINE]][c] '''<=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[XANTHOSINE-5-PHOSPHATE]][c]
+
** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ12523]]
+
** swkaczqjgxabcn-jsgwljpksa-n
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 737.203
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[RXN-2762]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[RXN-2761]]
{{#set: direction=reversible}}
+
== Reaction(s) of unknown directionality ==
{{#set: common-name=xmp:pyrophosphate phosphoribosyltransferase}}
+
{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=737.203}}
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite 2-METHYL-6-SOLANYL-14-BENZOQUINONE

  • common-name:
    • 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
  • inchi-key:
    • swkaczqjgxabcn-jsgwljpksa-n
  • molecular-weight:
    • 737.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality