|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYL-KIN-RXN GUANYL-KIN-RXN] == | + | == Metabolite 2-METHYL-ACETO-ACETYL-COA == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** guanylate kinase | + | ** 2-methylacetoacetyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.4.8 ec-2.7.4.8] | + | ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[GMP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GDP]][c]
| + | ** nhnodhrscralbf-nqnbqjknsa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ08624]]
| + | ** 861.604 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[1.1.1.178-RXN]] |
| − | ** Category: [[orthology]] | + | * [[ACCAT]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[HMNOS]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[METHYLACETOACETYLCOATHIOL-RXN]] |
| − | * Gene: [[SJ04335]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[1.1.1.178-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[HMNOS]] |
| − | ** Category: [[orthology]]
| + | * [[METHYLACETOACETYLCOATHIOL-RXN]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=2-methylacetoacetyl-coa}} |
| − | * Gene: [[SJ12276]]
| + | {{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=861.604}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221] | |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA: | |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20780 20780]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00332 R00332]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNB8 Q9PNB8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CEE3 Q9CEE3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JT96 Q9JT96]
| |
| − | ** [http://www.uniprot.org/uniprot/P44310 P44310]
| |
| − | ** [http://www.uniprot.org/uniprot/P15454 P15454]
| |
| − | ** [http://www.uniprot.org/uniprot/P60546 P60546]
| |
| − | ** [http://www.uniprot.org/uniprot/P31006 P31006]
| |
| − | ** [http://www.uniprot.org/uniprot/P46195 P46195]
| |
| − | ** [http://www.uniprot.org/uniprot/Q16774 Q16774]
| |
| − | ** [http://www.uniprot.org/uniprot/P72648 P72648]
| |
| − | ** [http://www.uniprot.org/uniprot/Q6RHR9 Q6RHR9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9M681 Q9M681]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=guanylate kinase}} | |
| − | {{#set: ec-number=ec-2.7.4.8}}
| |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}} | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
| |
