|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.13.3-RXN 2.7.13.3-RXN] == | + | == Metabolite 2-METHYL-ACETO-ACETYL-COA == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** protein histidine kinase | + | ** 2-methylacetoacetyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.13.3 ec-2.7.13.3] | + | ** cc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c(=o)c |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[Protein-Histidines]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Protein-phospho-L-histidines]][c]
| + | ** nhnodhrscralbf-nqnbqjknsa-j |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 861.604 |
| − | * Gene: [[SJ06042]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[1.1.1.178-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | * [[ACCAT]] |
| − | * Gene: [[SJ12462]]
| + | * [[HMNOS]] |
| − | ** Category: [[annotation]]
| + | * [[METHYLACETOACETYLCOATHIOL-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ15662]]
| + | * [[1.1.1.178-RXN]] |
| − | ** Category: [[annotation]]
| + | * [[HMNOS]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[METHYLACETOACETYLCOATHIOL-RXN]] |
| − | * Gene: [[SJ17704]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=2-methylacetoacetyl-coa}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | + | {{#set: inchi-key=inchikey=nhnodhrscralbf-nqnbqjknsa-j}} |
| − | * Gene: [[SJ00228]]
| + | {{#set: molecular-weight=861.604}} |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ02814]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20355]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ22385]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ17494]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ20634]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ19565]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ17553]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ09717]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ19858]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links ==
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=protein histidine kinase}} | |
| − | {{#set: ec-number=ec-2.7.13.3}}
| |
| − | {{#set: nb gene associated=14}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
