Difference between revisions of "2-METHYL-ACETO-ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYL-KIN-RXN GUANYL-KIN-RXN] == * direction: ** left-to-right * common-name: ** guanylate kinase...")
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GUANYL-KIN-RXN GUANYL-KIN-RXN] ==
+
== Metabolite GERANYLGERANYL-PP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** guanylate kinase
+
** geranylgeranyl diphosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.4.8 ec-2.7.4.8]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[GMP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GDP]][c]
+
** oinneunvozhbox-qircyjposa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ08624]]
+
** 447.424
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.5.1.32-RXN]]
** Category: [[orthology]]
+
* [[2.5.1.41-RXN]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.5.1.42-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10625]]
* Gene: [[SJ04335]]
+
* [[RXN-11486]]
** Category: [[annotation]]
+
* [[RXN-11488]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13323]]
** Category: [[orthology]]
+
* [[RXN-14929]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-17480]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-3701]]
* Gene: [[SJ12276]]
+
* [[RXN-7658]]
** Category: [[annotation]]
+
* [[RXN-7663]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-7673]]
== Pathway(s)  ==
+
* [[RXN-8788]]
* [[PWY-7221]], guanosine ribonucleotides de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7221 PWY-7221]
+
== Reaction(s) known to produce the compound ==
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
== Reconstruction information  ==
+
* [[GGPS]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-3701]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7658]]
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-7673]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
* RHEA:
+
{{#set: common-name=geranylgeranyl diphosphate}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20780 20780]
+
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
* LIGAND-RXN:
+
{{#set: molecular-weight=447.424}}
** [http://www.genome.jp/dbget-bin/www_bget?R00332 R00332]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/Q9PNB8 Q9PNB8]
 
** [http://www.uniprot.org/uniprot/Q9CEE3 Q9CEE3]
 
** [http://www.uniprot.org/uniprot/Q9JT96 Q9JT96]
 
** [http://www.uniprot.org/uniprot/P44310 P44310]
 
** [http://www.uniprot.org/uniprot/P15454 P15454]
 
** [http://www.uniprot.org/uniprot/P60546 P60546]
 
** [http://www.uniprot.org/uniprot/P31006 P31006]
 
** [http://www.uniprot.org/uniprot/P46195 P46195]
 
** [http://www.uniprot.org/uniprot/Q16774 Q16774]
 
** [http://www.uniprot.org/uniprot/P72648 P72648]
 
** [http://www.uniprot.org/uniprot/Q6RHR9 Q6RHR9]
 
** [http://www.uniprot.org/uniprot/Q9M681 Q9M681]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=guanylate kinase}}
 
{{#set: ec-number=ec-2.7.4.8}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:35, 18 December 2020

Metabolite GERANYLGERANYL-PP

  • common-name:
    • geranylgeranyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • oinneunvozhbox-qircyjposa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality