Difference between revisions of "2-METHYL-ACETO-ACETYL-COA"

Revision as of 14:57, 5 January 2021

smiles:
- ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
common-name:
- bacteriochlorophyllide a
molecular-weight:
- 630.982

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite GERANYLGERANYL-PP ==
+== Metabolite CPD-9066 ==
+* smiles:
+** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)[o-])c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)=cc5=6)))=cc8(=c(c)c(c(c)=o)=c(n78)c=9))))))
 * common-name:
-** geranylgeranyl diphosphate
+** bacteriochlorophyllide a
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
-* inchi-key:
-** oinneunvozhbox-qircyjposa-k
 * molecular-weight:
-** 447.424
+** 630.982
 == Reaction(s) known to consume the compound ==
-* [[2.5.1.32-RXN]]
-* [[2.5.1.41-RXN]]
-* [[2.5.1.42-RXN]]
-* [[RXN-10625]]
-* [[RXN-11486]]
-* [[RXN-11488]]
-* [[RXN-13323]]
-* [[RXN-14929]]
-* [[RXN-17480]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7663]]
-* [[RXN-7673]]
 * [[RXN-8788]]
 == Reaction(s) known to produce the compound ==
-* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[GGPS]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7673]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=geranylgeranyl diphosphate}}
+{{#set: common-name=bacteriochlorophyllide a}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
+{{#set: molecular-weight=630.982}}
-{{#set: molecular-weight=447.424}}