Difference between revisions of "2-METHYL-BUTYRYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...") |
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] * inchi-key: ** jdmup...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PANTETHEINE-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4'-phosphopantetheine |
* smiles: | * smiles: | ||
| − | ** cc(o)c( | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jdmuprlruumctl-vifpvbqesa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 356.33 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PANTEPADENYLYLTRAN-RXN]] |
| − | * [[RXN | + | * [[PANTETHEINE-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[3.1.4.14-RXN]] |
| + | * [[P-PANTOCYSDECARB-RXN]] | ||
| + | * [[PANTETHEINE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4'-phosphopantetheine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.33}} |
Revision as of 08:32, 15 March 2021
Contents
Metabolite PANTETHEINE-P
- common-name:
- 4'-phosphopantetheine
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
- inchi-key:
- jdmuprlruumctl-vifpvbqesa-l
- molecular-weight:
- 356.33
